C31H36ClN2O2RuS — CID 87275981
N-(1-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;chlororuthenium;1-methyl-4-propan-2-ylbenzene (PubChem CID 87275981) has the molecular formula C31H36ClN2O2RuS and a molecular weight of 637.23 g/mol. Its IUPAC name is N-(1-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;chlororuthenium;1-methyl-4-propan-2-ylbenzene.
| Compound Name | N-(1-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;chlororuthenium;1-methyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 87275981 |
| Molecular Formula | C31H36ClN2O2RuS |
| Molecular Weight | 637.23 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | N-(1-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;chlororuthenium;1-methyl-4-propan-2-ylbenzene |
| SMILES | Cc1ccc(C(C)C)cc1.Cc1ccc(S(=O)(=O)NC(N)(Cc2ccccc2)c2ccccc2)cc1.Cl[Ru] |
| InChI | InChI=1S/C21H22N2O2S.C10H14.ClH.Ru/c1-17-12-14-20(15-13-17)26(24,25)23-21(22,19-10-6-3-7-11-19)16-18-8-4-2-5-9-18;1-8(2)10-6-4-9(3)5-7-10;;/h2-15,23H,16,22H2,1H3;4-8H,1-3H3;1H;/q;;;+1/p-1 |
| InChIKey | VMQFQPIZGLSKEK-UHFFFAOYSA-M |
| XLogP | 7.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.23 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|