C31H35ClN2O2RuS — CID 87839974
N-[(1R,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;1-methyl-4-propan-2-ylbenzene;ruthenium (PubChem CID 87839974) has the molecular formula C31H35ClN2O2RuS and a molecular weight of 636.22 g/mol. Its IUPAC name is N-[(1R,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;1-methyl-4-propan-2-ylbenzene;ruthenium.
| Compound Name | N-[(1R,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;1-methyl-4-propan-2-ylbenzene;ruthenium |
|---|---|
| PubChem CID | 87839974 |
| Molecular Formula | C31H35ClN2O2RuS |
| Molecular Weight | 636.22 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | N-[(1R,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;1-methyl-4-propan-2-ylbenzene;ruthenium |
| SMILES | Cc1ccc(C(C)C)cc1.Cc1ccc(S(=O)(=O)N[C@@](Cl)(c2ccccc2)[C@@H](N)c2ccccc2)cc1.[Ru] |
| InChI | InChI=1S/C21H21ClN2O2S.C10H14.Ru/c1-16-12-14-19(15-13-16)27(25,26)24-21(22,18-10-6-3-7-11-18)20(23)17-8-4-2-5-9-17;1-8(2)10-6-4-9(3)5-7-10;/h2-15,20,24H,23H2,1H3;4-8H,1-3H3;/t20-,21-;;/m0../s1 |
| InChIKey | ZBTWPCWTVJTQCK-HRIAXCGHSA-N |
| XLogP | 7.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.22 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|