C21H21ClN2O3S — CID 70148428
N-[(1S,2R)-2-amino-1-chloro-1,2-diphenylethyl]-4-methoxybenzenesulfonamide (PubChem CID 70148428) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-[(1S,2R)-2-amino-1-chloro-1,2-diphenylethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(1S,2R)-2-amino-1-chloro-1,2-diphenylethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 70148428 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[(1S,2R)-2-amino-1-chloro-1,2-diphenylethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@](Cl)(c2ccccc2)[C@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-27-18-12-14-19(15-13-18)28(25,26)24-21(22,17-10-6-3-7-11-17)20(23)16-8-4-2-5-9-16/h2-15,20,24H,23H2,1H3/t20-,21-/m1/s1 |
| InChIKey | OGAXOWZSPIRSAG-NHCUHLMSSA-N |
| XLogP | 3.77 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|