C22H23NO3 — CID 11187177
(2S)-2-amino-1,1-bis(4-methoxyphenyl)-2-phenylethanol (PubChem CID 11187177) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2S)-2-amino-1,1-bis(4-methoxyphenyl)-2-phenylethanol.
| Compound Name | (2S)-2-amino-1,1-bis(4-methoxyphenyl)-2-phenylethanol |
|---|---|
| PubChem CID | 11187177 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (2S)-2-amino-1,1-bis(4-methoxyphenyl)-2-phenylethanol |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)[C@@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-25-19-12-8-17(9-13-19)22(24,18-10-14-20(26-2)15-11-18)21(23)16-6-4-3-5-7-16/h3-15,21,24H,23H2,1-2H3/t21-/m0/s1 |
| InChIKey | FMXHUQVRXDIDLF-NRFANRHFSA-N |
| XLogP | 3.64 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |