C24H24N2O5 — CID 141117187
N'-[(1R)-2-hydroxy-2,2-bis(4-methoxyphenyl)-1-phenylethyl]oxamide (PubChem CID 141117187) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N'-[(1R)-2-hydroxy-2,2-bis(4-methoxyphenyl)-1-phenylethyl]oxamide.
| Compound Name | N'-[(1R)-2-hydroxy-2,2-bis(4-methoxyphenyl)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 141117187 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N'-[(1R)-2-hydroxy-2,2-bis(4-methoxyphenyl)-1-phenylethyl]oxamide |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)[C@H](NC(=O)C(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O5/c1-30-19-12-8-17(9-13-19)24(29,18-10-14-20(31-2)15-11-18)21(26-23(28)22(25)27)16-6-4-3-5-7-16/h3-15,21,29H,1-2H3,(H2,25,27)(H,26,28)/t21-/m1/s1 |
| InChIKey | LDVCHLIOMINQDN-OAQYLSRUSA-N |
| XLogP | 2.28 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|