C55H50N2O8 — CID 23140891
N,N'-bis[2-hydroxy-2,2-bis(4-methoxyphenyl)-1-naphthalen-1-ylethyl]propanediamide (PubChem CID 23140891) has the molecular formula C55H50N2O8 and a molecular weight of 867.01 g/mol. Its IUPAC name is N,N'-bis[2-hydroxy-2,2-bis(4-methoxyphenyl)-1-naphthalen-1-ylethyl]propanediamide.
| Compound Name | N,N'-bis[2-hydroxy-2,2-bis(4-methoxyphenyl)-1-naphthalen-1-ylethyl]propanediamide |
|---|---|
| PubChem CID | 23140891 |
| Molecular Formula | C55H50N2O8 |
| Molecular Weight | 867.01 g/mol |
| Exact Mass | 866.36 |
| IUPAC Name | N,N'-bis[2-hydroxy-2,2-bis(4-methoxyphenyl)-1-naphthalen-1-ylethyl]propanediamide |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)C(NC(=O)CC(=O)NC(c2cccc3ccccc23)C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C55H50N2O8/c1-62-42-27-19-38(20-28-42)54(60,39-21-29-43(63-2)30-22-39)52(48-17-9-13-36-11-5-7-15-46(36)48)56-50(58)35-51(59)57-53(49-18-10-14-37-12-6-8-16-47(37)49)55(61,40-23-31-44(64-3)32-24-40)41-25-33-45(65-4)34-26-41/h5-34,52-53,60-61H,35H2,1-4H3,(H,56,58)(H,57,59) |
| InChIKey | CUGCORALWXFTDO-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.01 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|