C51H74N2O4 — CID 67534057
N,N'-bis[(1S)-2-hexyl-2-hydroxy-1-naphthalen-1-yloctyl]propanediamide (PubChem CID 67534057) has the molecular formula C51H74N2O4 and a molecular weight of 779.16 g/mol. Its IUPAC name is N,N'-bis[(1S)-2-hexyl-2-hydroxy-1-naphthalen-1-yloctyl]propanediamide.
| Compound Name | N,N'-bis[(1S)-2-hexyl-2-hydroxy-1-naphthalen-1-yloctyl]propanediamide |
|---|---|
| PubChem CID | 67534057 |
| Molecular Formula | C51H74N2O4 |
| Molecular Weight | 779.16 g/mol |
| Exact Mass | 778.56 |
| IUPAC Name | N,N'-bis[(1S)-2-hexyl-2-hydroxy-1-naphthalen-1-yloctyl]propanediamide |
| SMILES | CCCCCCC(O)(CCCCCC)[C@@H](NC(=O)CC(=O)N[C@@H](c1cccc2ccccc12)C(O)(CCCCCC)CCCCCC)c1cccc2ccccc12 |
| InChI | InChI=1S/C51H74N2O4/c1-5-9-13-21-35-50(56,36-22-14-10-6-2)48(44-33-25-29-40-27-17-19-31-42(40)44)52-46(54)39-47(55)53-49(45-34-26-30-41-28-18-20-32-43(41)45)51(57,37-23-15-11-7-3)38-24-16-12-8-4/h17-20,25-34,48-49,56-57H,5-16,21-24,35-39H2,1-4H3,(H,52,54)(H,53,55)/t48-,49-/m0/s1 |
| InChIKey | HLJIXXWVKGUXSL-GTMCEHENSA-N |
| XLogP | 12.74 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.16 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|