C59H58N2O8 — CID 87160958
N,N'-bis[(1S)-2-hydroxy-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-1-ylpropyl]propanediamide (PubChem CID 87160958) has the molecular formula C59H58N2O8 and a molecular weight of 923.12 g/mol. Its IUPAC name is N,N'-bis[(1S)-2-hydroxy-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-1-ylpropyl]propanediamide.
| Compound Name | N,N'-bis[(1S)-2-hydroxy-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-1-ylpropyl]propanediamide |
|---|---|
| PubChem CID | 87160958 |
| Molecular Formula | C59H58N2O8 |
| Molecular Weight | 923.12 g/mol |
| Exact Mass | 922.42 |
| IUPAC Name | N,N'-bis[(1S)-2-hydroxy-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-1-ylpropyl]propanediamide |
| SMILES | COc1ccc(CC(O)(Cc2ccc(OC)cc2)[C@@H](NC(=O)CC(=O)N[C@@H](c2cccc3ccccc23)C(O)(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C59H58N2O8/c1-66-46-27-19-40(20-28-46)36-58(64,37-41-21-29-47(67-2)30-22-41)56(52-17-9-13-44-11-5-7-15-50(44)52)60-54(62)35-55(63)61-57(53-18-10-14-45-12-6-8-16-51(45)53)59(65,38-42-23-31-48(68-3)32-24-42)39-43-25-33-49(69-4)34-26-43/h5-34,56-57,64-65H,35-39H2,1-4H3,(H,60,62)(H,61,63)/t56-,57-/m0/s1 |
| InChIKey | LOXNUXZUUYHJAU-KXLPFTAXSA-N |
| XLogP | 9.87 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.12 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|