C71H58N2O4 — CID 87160860
N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide (PubChem CID 87160860) has the molecular formula C71H58N2O4 and a molecular weight of 1003.26 g/mol. Its IUPAC name is N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide.
| Compound Name | N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide |
|---|---|
| PubChem CID | 87160860 |
| Molecular Formula | C71H58N2O4 |
| Molecular Weight | 1003.26 g/mol |
| Exact Mass | 1002.44 |
| IUPAC Name | N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide |
| SMILES | O=C(CC(=O)N[C@@H](c1cccc2ccccc12)C(O)(Cc1ccc2ccccc2c1)Cc1ccc2ccccc2c1)N[C@@H](c1cccc2ccccc12)C(O)(Cc1ccc2ccccc2c1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C71H58N2O4/c74-66(72-68(64-29-13-25-56-19-9-11-27-62(56)64)70(76,44-48-31-35-52-15-1-5-21-58(52)39-48)45-49-32-36-53-16-2-6-22-59(53)40-49)43-67(75)73-69(65-30-14-26-57-20-10-12-28-63(57)65)71(77,46-50-33-37-54-17-3-7-23-60(54)41-50)47-51-34-38-55-18-4-8-24-61(55)42-51/h1-42,68-69,76-77H,43-47H2,(H,72,74)(H,73,75)/t68-,69-/m0/s1 |
| InChIKey | VQGRANGOQRTSFQ-NNAPYRDBSA-N |
| XLogP | 14.44 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.26 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|