C51H42N2O4 — CID 69009990
N,N'-bis[(1R)-2-hydroxy-1-naphthalen-1-yl-2,2-diphenylethyl]propanediamide (PubChem CID 69009990) has the molecular formula C51H42N2O4 and a molecular weight of 746.91 g/mol. Its IUPAC name is N,N'-bis[(1R)-2-hydroxy-1-naphthalen-1-yl-2,2-diphenylethyl]propanediamide.
| Compound Name | N,N'-bis[(1R)-2-hydroxy-1-naphthalen-1-yl-2,2-diphenylethyl]propanediamide |
|---|---|
| PubChem CID | 69009990 |
| Molecular Formula | C51H42N2O4 |
| Molecular Weight | 746.91 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | N,N'-bis[(1R)-2-hydroxy-1-naphthalen-1-yl-2,2-diphenylethyl]propanediamide |
| SMILES | O=C(CC(=O)N[C@H](c1cccc2ccccc12)C(O)(c1ccccc1)c1ccccc1)N[C@H](c1cccc2ccccc12)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H42N2O4/c54-46(52-48(44-33-17-21-36-19-13-15-31-42(36)44)50(56,38-23-5-1-6-24-38)39-25-7-2-8-26-39)35-47(55)53-49(45-34-18-22-37-20-14-16-32-43(37)45)51(57,40-27-9-3-10-28-40)41-29-11-4-12-30-41/h1-34,48-49,56-57H,35H2,(H,52,54)(H,53,55)/t48-,49-/m1/s1 |
| InChIKey | MFSWFUVHBKGXFF-YYACYCFASA-N |
| XLogP | 9.27 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.91 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|