C40H50N2O4 — CID 66807731
1-N,1-N'-bis[(1S)-2-ethyl-2-hydroxy-1-naphthalen-1-ylbutyl]cyclohexane-1,1-dicarboxamide (PubChem CID 66807731) has the molecular formula C40H50N2O4 and a molecular weight of 622.85 g/mol. Its IUPAC name is 1-N,1-N'-bis[(1S)-2-ethyl-2-hydroxy-1-naphthalen-1-ylbutyl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(1S)-2-ethyl-2-hydroxy-1-naphthalen-1-ylbutyl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66807731 |
| Molecular Formula | C40H50N2O4 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.38 |
| IUPAC Name | 1-N,1-N'-bis[(1S)-2-ethyl-2-hydroxy-1-naphthalen-1-ylbutyl]cyclohexane-1,1-dicarboxamide |
| SMILES | CCC(O)(CC)[C@@H](NC(=O)C1(C(=O)N[C@@H](c2cccc3ccccc23)C(O)(CC)CC)CCCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C40H50N2O4/c1-5-39(45,6-2)34(32-24-16-20-28-18-10-12-22-30(28)32)41-36(43)38(26-14-9-15-27-38)37(44)42-35(40(46,7-3)8-4)33-25-17-21-29-19-11-13-23-31(29)33/h10-13,16-25,34-35,45-46H,5-9,14-15,26-27H2,1-4H3,(H,41,43)(H,42,44)/t34-,35-/m0/s1 |
| InChIKey | PJEYUHQYSJFGAC-PXLJZGITSA-N |
| XLogP | 8.06 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|