C23H21F3O2 — CID 168720238
1,1,1-trifluoro-2-(4-methoxyphenyl)-4,4-diphenylbutan-2-ol (PubChem CID 168720238) has the molecular formula C23H21F3O2 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(4-methoxyphenyl)-4,4-diphenylbutan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(4-methoxyphenyl)-4,4-diphenylbutan-2-ol |
|---|---|
| PubChem CID | 168720238 |
| Molecular Formula | C23H21F3O2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1,1,1-trifluoro-2-(4-methoxyphenyl)-4,4-diphenylbutan-2-ol |
| SMILES | COc1ccc(C(O)(CC(c2ccccc2)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3O2/c1-28-20-14-12-19(13-15-20)22(27,23(24,25)26)16-21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,21,27H,16H2,1H3 |
| InChIKey | UOPKHPVODCCUKD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |