C14H15F3O5 — CID 122573519
6,6,6-trifluoro-5-hydroxy-5-(4-methoxyphenyl)-2-methyl-3-oxohexanoic acid (PubChem CID 122573519) has the molecular formula C14H15F3O5 and a molecular weight of 320.26 g/mol. Its IUPAC name is 6,6,6-trifluoro-5-hydroxy-5-(4-methoxyphenyl)-2-methyl-3-oxohexanoic acid.
| Compound Name | 6,6,6-trifluoro-5-hydroxy-5-(4-methoxyphenyl)-2-methyl-3-oxohexanoic acid |
|---|---|
| PubChem CID | 122573519 |
| Molecular Formula | C14H15F3O5 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6,6,6-trifluoro-5-hydroxy-5-(4-methoxyphenyl)-2-methyl-3-oxohexanoic acid |
| SMILES | COc1ccc(C(O)(CC(=O)C(C)C(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3O5/c1-8(12(19)20)11(18)7-13(21,14(15,16)17)9-3-5-10(22-2)6-4-9/h3-6,8,21H,7H2,1-2H3,(H,19,20) |
| InChIKey | XBPRVLZNXUDIFX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|