C16H23F3O2Si — CID 132567578
(E)-1,1,1-trifluoro-2-(4-methoxyphenyl)-6-trimethylsilylhex-4-en-2-ol (PubChem CID 132567578) has the molecular formula C16H23F3O2Si and a molecular weight of 332.44 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-2-(4-methoxyphenyl)-6-trimethylsilylhex-4-en-2-ol.
| Compound Name | (E)-1,1,1-trifluoro-2-(4-methoxyphenyl)-6-trimethylsilylhex-4-en-2-ol |
|---|---|
| PubChem CID | 132567578 |
| Molecular Formula | C16H23F3O2Si |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (E)-1,1,1-trifluoro-2-(4-methoxyphenyl)-6-trimethylsilylhex-4-en-2-ol |
| SMILES | COc1ccc(C(O)(C/C=C/C[Si](C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H23F3O2Si/c1-21-14-9-7-13(8-10-14)15(20,16(17,18)19)11-5-6-12-22(2,3)4/h5-10,20H,11-12H2,1-4H3/b6-5+ |
| InChIKey | BAWIPPFRFJASAT-AATRIKPKSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|