C17H22N2O2 — CID 70511217
2-(4-methoxyphenyl)-3,3-dimethyl-1-pyrimidin-5-ylbutan-2-ol (PubChem CID 70511217) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3,3-dimethyl-1-pyrimidin-5-ylbutan-2-ol.
| Compound Name | 2-(4-methoxyphenyl)-3,3-dimethyl-1-pyrimidin-5-ylbutan-2-ol |
|---|---|
| PubChem CID | 70511217 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-3,3-dimethyl-1-pyrimidin-5-ylbutan-2-ol |
| SMILES | COc1ccc(C(O)(Cc2cncnc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H22N2O2/c1-16(2,3)17(20,9-13-10-18-12-19-11-13)14-5-7-15(21-4)8-6-14/h5-8,10-12,20H,9H2,1-4H3 |
| InChIKey | YVWZJWDOXVWDNS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |