C21H28 — CID 170780571
1-(2-phenylpropan-2-yl)-2,4-di(propan-2-yl)benzene (PubChem CID 170780571) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1-(2-phenylpropan-2-yl)-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-(2-phenylpropan-2-yl)-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 170780571 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-(2-phenylpropan-2-yl)-2,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(C(C)(C)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C21H28/c1-15(2)17-12-13-20(19(14-17)16(3)4)21(5,6)18-10-8-7-9-11-18/h7-16H,1-6H3 |
| InChIKey | QDPKEBDOYIOLAK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |