C16H22F2O2 — CID 29051981
4-[2,4-di(propan-2-yl)phenyl]-4,4-difluorobutanoic acid (PubChem CID 29051981) has the molecular formula C16H22F2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-[2,4-di(propan-2-yl)phenyl]-4,4-difluorobutanoic acid.
| Compound Name | 4-[2,4-di(propan-2-yl)phenyl]-4,4-difluorobutanoic acid |
|---|---|
| PubChem CID | 29051981 |
| Molecular Formula | C16H22F2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-[2,4-di(propan-2-yl)phenyl]-4,4-difluorobutanoic acid |
| SMILES | CC(C)c1ccc(C(F)(F)CCC(=O)O)c(C(C)C)c1 |
| InChI | InChI=1S/C16H22F2O2/c1-10(2)12-5-6-14(13(9-12)11(3)4)16(17,18)8-7-15(19)20/h5-6,9-11H,7-8H2,1-4H3,(H,19,20) |
| InChIKey | QGXOZBSEWPKQDG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |