C19H23NO — CID 171500785
2-methanimidoyl-6-(2-phenylpropan-2-yl)-4-propan-2-ylphenol (PubChem CID 171500785) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-methanimidoyl-6-(2-phenylpropan-2-yl)-4-propan-2-ylphenol.
| Compound Name | 2-methanimidoyl-6-(2-phenylpropan-2-yl)-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 171500785 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-methanimidoyl-6-(2-phenylpropan-2-yl)-4-propan-2-ylphenol |
| SMILES | [H]/N=C/c1cc(C(C)C)cc(C(C)(C)c2ccccc2)c1O |
| InChI | InChI=1S/C19H23NO/c1-13(2)14-10-15(12-20)18(21)17(11-14)19(3,4)16-8-6-5-7-9-16/h5-13,20-21H,1-4H3/b20-12+ |
| InChIKey | KIHZLZFRRNZSDS-UDWIEESQSA-N |
| XLogP | 4.84 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|