C35H54N2O — CID 144903145
2-tert-butyl-6-methanimidoyl-4-propan-2-ylphenol;N-cyclohexyl-1-(3,5-ditert-butylphenyl)methanimine (PubChem CID 144903145) has the molecular formula C35H54N2O and a molecular weight of 518.83 g/mol. Its IUPAC name is 2-tert-butyl-6-methanimidoyl-4-propan-2-ylphenol;N-cyclohexyl-1-(3,5-ditert-butylphenyl)methanimine.
| Compound Name | 2-tert-butyl-6-methanimidoyl-4-propan-2-ylphenol;N-cyclohexyl-1-(3,5-ditert-butylphenyl)methanimine |
|---|---|
| PubChem CID | 144903145 |
| Molecular Formula | C35H54N2O |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.42 |
| IUPAC Name | 2-tert-butyl-6-methanimidoyl-4-propan-2-ylphenol;N-cyclohexyl-1-(3,5-ditert-butylphenyl)methanimine |
| SMILES | CC(C)(C)c1cc(/C=N/C2CCCCC2)cc(C(C)(C)C)c1.[H]/N=C/c1cc(C(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H33N.C14H21NO/c1-20(2,3)17-12-16(13-18(14-17)21(4,5)6)15-22-19-10-8-7-9-11-19;1-9(2)10-6-11(8-15)13(16)12(7-10)14(3,4)5/h12-15,19H,7-11H2,1-6H3;6-9,15-16H,1-5H3/b22-15+;15-8+ |
| InChIKey | ZIRACOFGEYJWMU-ZVBZEWMZSA-N |
| XLogP | 9.84 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|