C12H18Cl2O2S — CID 174899363
1,3-di(propan-2-yl)benzene;sulfuryl dichloride (PubChem CID 174899363) has the molecular formula C12H18Cl2O2S and a molecular weight of 297.25 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)benzene;sulfuryl dichloride.
| Compound Name | 1,3-di(propan-2-yl)benzene;sulfuryl dichloride |
|---|---|
| PubChem CID | 174899363 |
| Molecular Formula | C12H18Cl2O2S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1,3-di(propan-2-yl)benzene;sulfuryl dichloride |
| SMILES | CC(C)c1cccc(C(C)C)c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C12H18.Cl2O2S/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-5(2,3)4/h5-10H,1-4H3; |
| InChIKey | RTSRBYXGIAEXRW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |