About 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine
1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine (PubChem CID 158378690) has the molecular formula C23H35N
and a molecular weight of 325.54 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine.
Molecular Properties
| Compound Name | 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine |
| PubChem CID | 158378690 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine |
| SMILES | CC(C)c1cccc(C(C)C)c1.CC(C)c1cccc(C(C)C)n1 |
| InChI | InChI=1S/C12H18.C11H17N/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-8(2)10-6-5-7-11(12-10)9(3)4/h5-10H,1-4H3;5-9H,1-4H3 |
| InChIKey | GVNCVXMPUBYYGD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine?
The IUPAC name of 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine (CID 158378690) is 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine.
What is the SMILES notation for 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine?
The canonical SMILES for 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine is CC(C)c1cccc(C(C)C)c1.CC(C)c1cccc(C(C)C)n1.
What is the InChIKey of 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine?
The InChIKey is GVNCVXMPUBYYGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C11H17N/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-8(2)10-6-5-7-11(12-10)9(3)4/h5-10H,1-4H3;5-9H,1-4H3.
What are the key properties of 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine?
1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine has a molecular weight of 325.54 g/mol, XLogP of 7.26, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(propan-2-yl)benzene;2,6-di(propan-2-yl)pyridine is sourced from PubChem (CID 158378690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).