About 3-propan-2-ylphenolate
3-propan-2-ylphenolate (PubChem CID 101030156) has the molecular formula C9H11O-
and a molecular weight of 135.19 g/mol. Its IUPAC name is 3-propan-2-ylphenolate.
Molecular Properties
| Compound Name | 3-propan-2-ylphenolate |
| PubChem CID | 101030156 |
| Molecular Formula | C9H11O- |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 3-propan-2-ylphenolate |
| SMILES | CC(C)c1cccc([O-])c1 |
| InChI | InChI=1S/C9H12O/c1-7(2)8-4-3-5-9(10)6-8/h3-7,10H,1-2H3/p-1 |
| InChIKey | VLJSLTNSFSOYQR-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propan-2-ylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylphenolate?
The IUPAC name of 3-propan-2-ylphenolate (CID 101030156) is 3-propan-2-ylphenolate.
What is the SMILES notation for 3-propan-2-ylphenolate?
The canonical SMILES for 3-propan-2-ylphenolate is CC(C)c1cccc([O-])c1.
What is the InChIKey of 3-propan-2-ylphenolate?
The InChIKey is VLJSLTNSFSOYQR-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12O/c1-7(2)8-4-3-5-9(10)6-8/h3-7,10H,1-2H3/p-1.
What are the key properties of 3-propan-2-ylphenolate?
3-propan-2-ylphenolate has a molecular weight of 135.19 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylphenolate is sourced from PubChem (CID 101030156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).