C14H22O6S2 — CID 135297196
dimethyl 4,6-di(propan-2-yl)benzene-1,3-disulfonate (PubChem CID 135297196) has the molecular formula C14H22O6S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is dimethyl 4,6-di(propan-2-yl)benzene-1,3-disulfonate.
| Compound Name | dimethyl 4,6-di(propan-2-yl)benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 135297196 |
| Molecular Formula | C14H22O6S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | dimethyl 4,6-di(propan-2-yl)benzene-1,3-disulfonate |
| SMILES | COS(=O)(=O)c1cc(S(=O)(=O)OC)c(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C14H22O6S2/c1-9(2)11-7-12(10(3)4)14(22(17,18)20-6)8-13(11)21(15,16)19-5/h7-10H,1-6H3 |
| InChIKey | NFVNZJWINVIBIR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|