C9H12O9S4Zn2 — CID 162139474
trimethyl 2-sulfanylbenzene-1,3,5-trisulfonate;zinc (PubChem CID 162139474) has the molecular formula C9H12O9S4Zn2 and a molecular weight of 523.23 g/mol. Its IUPAC name is trimethyl 2-sulfanylbenzene-1,3,5-trisulfonate;zinc.
| Compound Name | trimethyl 2-sulfanylbenzene-1,3,5-trisulfonate;zinc |
|---|---|
| PubChem CID | 162139474 |
| Molecular Formula | C9H12O9S4Zn2 |
| Molecular Weight | 523.23 g/mol |
| Exact Mass | 519.79 |
| IUPAC Name | trimethyl 2-sulfanylbenzene-1,3,5-trisulfonate;zinc |
| SMILES | COS(=O)(=O)c1cc(S(=O)(=O)OC)c(S)c(S(=O)(=O)OC)c1.[Zn].[Zn] |
| InChI | InChI=1S/C9H12O9S4.2Zn/c1-16-20(10,11)6-4-7(21(12,13)17-2)9(19)8(5-6)22(14,15)18-3;;/h4-5,19H,1-3H3;; |
| InChIKey | ZJSSZLNRDUDOFM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|