About N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide
N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide (PubChem CID 22263501) has the molecular formula C15H23N3O2S
and a molecular weight of 309.44 g/mol. Its IUPAC name is N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide |
| PubChem CID | 22263501 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N=[N+]=[N-])cc1C(C)C |
| InChI | InChI=1S/C15H23N3O2S/c1-9(2)12-7-14(11(5)6)15(8-13(12)10(3)4)21(19,20)18-17-16/h7-11H,1-6H3 |
| InChIKey | OPKZXGDPULRRSF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide?
The IUPAC name of N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide (CID 22263501) is N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide.
What is the SMILES notation for N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide?
The canonical SMILES for N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide is CC(C)c1cc(C(C)C)c(S(=O)(=O)N=[N+]=[N-])cc1C(C)C.
What is the InChIKey of N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide?
The InChIKey is OPKZXGDPULRRSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2S/c1-9(2)12-7-14(11(5)6)15(8-13(12)10(3)4)21(19,20)18-17-16/h7-11H,1-6H3.
What are the key properties of N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide?
N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide has a molecular weight of 309.44 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide is sourced from PubChem (CID 22263501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).