C15H23N3O2S — CID 22263501
N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide (PubChem CID 22263501) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22263501 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-diazo-2,4,5-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N=[N+]=[N-])cc1C(C)C |
| InChI | InChI=1S/C15H23N3O2S/c1-9(2)12-7-14(11(5)6)15(8-13(12)10(3)4)21(19,20)18-17-16/h7-11H,1-6H3 |
| InChIKey | OPKZXGDPULRRSF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|