C16H25N2O2S+ — CID 159723459
methylidene-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminoazanium (PubChem CID 159723459) has the molecular formula C16H25N2O2S+ and a molecular weight of 309.46 g/mol. Its IUPAC name is methylidene-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminoazanium.
| Compound Name | methylidene-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminoazanium |
|---|---|
| PubChem CID | 159723459 |
| Molecular Formula | C16H25N2O2S+ |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methylidene-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminoazanium |
| SMILES | C=[N+]=NS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C16H25N2O2S/c1-10(2)13-8-14(11(3)4)16(15(9-13)12(5)6)21(19,20)18-17-7/h8-12H,7H2,1-6H3/q+1 |
| InChIKey | MCBATHJXJAUTSP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|