C26H31NO4 — CID 69217714
methyl (Z)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1,2-benzoxazol-5-yl]but-2-enoate (PubChem CID 69217714) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is methyl (Z)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1,2-benzoxazol-5-yl]but-2-enoate.
| Compound Name | methyl (Z)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1,2-benzoxazol-5-yl]but-2-enoate |
|---|---|
| PubChem CID | 69217714 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | methyl (Z)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1,2-benzoxazol-5-yl]but-2-enoate |
| SMILES | CCOc1c(-c2noc3ccc(/C(C)=C\C(=O)OC)cc23)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C26H31NO4/c1-8-30-26-20(16(4)5)13-19(15(2)3)14-22(26)25-21-12-18(9-10-23(21)31-27-25)17(6)11-24(28)29-7/h9-16H,8H2,1-7H3/b17-11- |
| InChIKey | AFFOSQIRDCZWDG-BOPFTXTBSA-N |
| XLogP | 6.72 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|