About ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate
ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate (PubChem CID 59682076) has the molecular formula C29H36O4
and a molecular weight of 448.60 g/mol. Its IUPAC name is ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate |
| PubChem CID | 59682076 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate |
| SMILES | CCCOc1c(-c2cccc3cc(/C(C)=C/C(=O)OCC)oc23)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C29H36O4/c1-8-13-32-29-24(19(5)6)15-22(18(3)4)16-25(29)23-12-10-11-21-17-26(33-28(21)23)20(7)14-27(30)31-9-2/h10-12,14-19H,8-9,13H2,1-7H3/b20-14+ |
| InChIKey | XSAHYDROKSYKQU-XSFVSMFZSA-N |
| XLogP | 8.10 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate?
The IUPAC name of ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate (CID 59682076) is ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate.
What is the SMILES notation for ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate?
The canonical SMILES for ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate is CCCOc1c(-c2cccc3cc(/C(C)=C/C(=O)OCC)oc23)cc(C(C)C)cc1C(C)C.
What is the InChIKey of ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate?
The InChIKey is XSAHYDROKSYKQU-XSFVSMFZSA-N. The full InChI is InChI=1S/C29H36O4/c1-8-13-32-29-24(19(5)6)15-22(18(3)4)16-25(29)23-12-10-11-21-17-26(33-28(21)23)20(7)14-27(30)31-9-2/h10-12,14-19H,8-9,13H2,1-7H3/b20-14+.
What are the key properties of ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate?
ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate has a molecular weight of 448.60 g/mol, XLogP of 8.10, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoate is sourced from PubChem (CID 59682076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).