C20H23NO7 — CID 69064392
4-[[2-[4-[(2-ethoxy-2-oxoethyl)amino]-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid (PubChem CID 69064392) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is 4-[[2-[4-[(2-ethoxy-2-oxoethyl)amino]-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid.
| Compound Name | 4-[[2-[4-[(2-ethoxy-2-oxoethyl)amino]-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 69064392 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-[[2-[4-[(2-ethoxy-2-oxoethyl)amino]-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid |
| SMILES | CCOC(=O)CNC(=O)C=C(C)c1cc2cccc(OCCCC(=O)O)c2o1 |
| InChI | InChI=1S/C20H23NO7/c1-3-26-19(25)12-21-17(22)10-13(2)16-11-14-6-4-7-15(20(14)28-16)27-9-5-8-18(23)24/h4,6-7,10-11H,3,5,8-9,12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | YPSCXHSNMIRZSU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|