C28H37NO7 — CID 11752373
ethyl (E)-3-[4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-7-(4-ethoxy-4-oxobutoxy)-1-benzofuran-2-yl]but-2-enoate (PubChem CID 11752373) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-7-(4-ethoxy-4-oxobutoxy)-1-benzofuran-2-yl]but-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-7-(4-ethoxy-4-oxobutoxy)-1-benzofuran-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 11752373 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-7-(4-ethoxy-4-oxobutoxy)-1-benzofuran-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)c1cc2c(/C(C)=C/C(=O)N(CC)CC)ccc(OCCCC(=O)OCC)c2o1 |
| InChI | InChI=1S/C28H37NO7/c1-7-29(8-2)25(30)16-19(5)21-13-14-23(35-15-11-12-26(31)33-9-3)28-22(21)18-24(36-28)20(6)17-27(32)34-10-4/h13-14,16-18H,7-12,15H2,1-6H3/b19-16+,20-17+ |
| InChIKey | ZCFFZAGOVIOJCX-VQZJLROISA-N |
| XLogP | 5.39 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|