C24H31NO7 — CID 70949548
(E)-3-[7-(3-carboxypropoxy)-4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2,3-dihydro-1-benzofuran-2-yl]but-2-enoic acid (PubChem CID 70949548) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is (E)-3-[7-(3-carboxypropoxy)-4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2,3-dihydro-1-benzofuran-2-yl]but-2-enoic acid.
| Compound Name | (E)-3-[7-(3-carboxypropoxy)-4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2,3-dihydro-1-benzofuran-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 70949548 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (E)-3-[7-(3-carboxypropoxy)-4-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]-2,3-dihydro-1-benzofuran-2-yl]but-2-enoic acid |
| SMILES | CCN(CC)C(=O)/C=C(\C)c1ccc(OCCCC(=O)O)c2c1CC(/C(C)=C/C(=O)O)O2 |
| InChI | InChI=1S/C24H31NO7/c1-5-25(6-2)21(26)12-15(3)17-9-10-19(31-11-7-8-22(27)28)24-18(17)14-20(32-24)16(4)13-23(29)30/h9-10,12-13,20H,5-8,11,14H2,1-4H3,(H,27,28)(H,29,30)/b15-12+,16-13+ |
| InChIKey | IQIGVPDQKXZBPR-WSGPNKEYSA-N |
| XLogP | 3.54 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|