C29H31NO4S — CID 70245124
2-[2-benzhydrylsulfanyl-5-[4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid (PubChem CID 70245124) has the molecular formula C29H31NO4S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-[2-benzhydrylsulfanyl-5-[4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-benzhydrylsulfanyl-5-[4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 70245124 |
| Molecular Formula | C29H31NO4S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[2-benzhydrylsulfanyl-5-[4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid |
| SMILES | CCN(CC)C(=O)C=C(C)c1ccc(SC(c2ccccc2)c2ccccc2)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C29H31NO4S/c1-4-30(5-2)27(31)18-21(3)24-16-17-26(25(19-24)34-20-28(32)33)35-29(22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-19,29H,4-5,20H2,1-3H3,(H,32,33) |
| InChIKey | JLGPHOFUAWNPSX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|