C31H35NO5 — CID 10839153
ethyl 2-[2-benzhydryloxy-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetate (PubChem CID 10839153) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is ethyl 2-[2-benzhydryloxy-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-benzhydryloxy-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 10839153 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | ethyl 2-[2-benzhydryloxy-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(/C(C)=C/C(=O)N(CC)CC)ccc1OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35NO5/c1-5-32(6-2)29(33)20-23(4)26-18-19-27(28(21-26)36-22-30(34)35-7-3)37-31(24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-21,31H,5-7,22H2,1-4H3/b23-20+ |
| InChIKey | BLTGCRIFUUNELS-BSYVCWPDSA-N |
| XLogP | 6.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|