C14H17NO7 — CID 23356773
2-[4-(2-aminoacetyl)-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetic acid (PubChem CID 23356773) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-[4-(2-aminoacetyl)-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetic acid.
| Compound Name | 2-[4-(2-aminoacetyl)-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetic acid |
|---|---|
| PubChem CID | 23356773 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[4-(2-aminoacetyl)-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetic acid |
| SMILES | CCOC(=O)COc1cc(C(=O)CN)ccc1OCC(=O)O |
| InChI | InChI=1S/C14H17NO7/c1-2-20-14(19)8-22-12-5-9(10(16)6-15)3-4-11(12)21-7-13(17)18/h3-5H,2,6-8,15H2,1H3,(H,17,18) |
| InChIKey | WBOLNHGQKNJLDJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |