C16H23NO4S2 — CID 67247425
ethyl 2-[4-(2-aminoacetyl)-2,6-bis(ethylsulfanyl)phenoxy]acetate (PubChem CID 67247425) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is ethyl 2-[4-(2-aminoacetyl)-2,6-bis(ethylsulfanyl)phenoxy]acetate.
| Compound Name | ethyl 2-[4-(2-aminoacetyl)-2,6-bis(ethylsulfanyl)phenoxy]acetate |
|---|---|
| PubChem CID | 67247425 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | ethyl 2-[4-(2-aminoacetyl)-2,6-bis(ethylsulfanyl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(SCC)cc(C(=O)CN)cc1SCC |
| InChI | InChI=1S/C16H23NO4S2/c1-4-20-15(19)10-21-16-13(22-5-2)7-11(12(18)9-17)8-14(16)23-6-3/h7-8H,4-6,9-10,17H2,1-3H3 |
| InChIKey | BDOFNSPQUQVDNM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |