C13H13NO7 — CID 131990889
2-[2-(2-nitroso-2-oxoethoxy)-4-propanoylphenoxy]acetic acid (PubChem CID 131990889) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-[2-(2-nitroso-2-oxoethoxy)-4-propanoylphenoxy]acetic acid.
| Compound Name | 2-[2-(2-nitroso-2-oxoethoxy)-4-propanoylphenoxy]acetic acid |
|---|---|
| PubChem CID | 131990889 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[2-(2-nitroso-2-oxoethoxy)-4-propanoylphenoxy]acetic acid |
| SMILES | CCC(=O)c1ccc(OCC(=O)O)c(OCC(=O)N=O)c1 |
| InChI | InChI=1S/C13H13NO7/c1-2-9(15)8-3-4-10(21-7-13(17)18)11(5-8)20-6-12(16)14-19/h3-5H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | GHXDIANGTDWNNN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |