C25H33NO3 — CID 86757415
(E)-N,N-diethyl-3-[3-(3-hydroxypropyl)-4-(1-phenylethoxy)phenyl]but-2-enamide (PubChem CID 86757415) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-[3-(3-hydroxypropyl)-4-(1-phenylethoxy)phenyl]but-2-enamide.
| Compound Name | (E)-N,N-diethyl-3-[3-(3-hydroxypropyl)-4-(1-phenylethoxy)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 86757415 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (E)-N,N-diethyl-3-[3-(3-hydroxypropyl)-4-(1-phenylethoxy)phenyl]but-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C(\C)c1ccc(OC(C)c2ccccc2)c(CCCO)c1 |
| InChI | InChI=1S/C25H33NO3/c1-5-26(6-2)25(28)17-19(3)22-14-15-24(23(18-22)13-10-16-27)29-20(4)21-11-8-7-9-12-21/h7-9,11-12,14-15,17-18,20,27H,5-6,10,13,16H2,1-4H3/b19-17+ |
| InChIKey | HQUIBKOWPJUNLI-HTXNQAPBSA-N |
| XLogP | 5.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|