C23H26ClNO5 — CID 10646359
2-[2-[(2-chlorophenyl)methoxy]-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid (PubChem CID 10646359) has the molecular formula C23H26ClNO5 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methoxy]-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(2-chlorophenyl)methoxy]-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10646359 |
| Molecular Formula | C23H26ClNO5 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methoxy]-5-[(E)-4-(diethylamino)-4-oxobut-2-en-2-yl]phenoxy]acetic acid |
| SMILES | CCN(CC)C(=O)/C=C(\C)c1ccc(OCc2ccccc2Cl)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C23H26ClNO5/c1-4-25(5-2)22(26)12-16(3)17-10-11-20(21(13-17)30-15-23(27)28)29-14-18-8-6-7-9-19(18)24/h6-13H,4-5,14-15H2,1-3H3,(H,27,28)/b16-12+ |
| InChIKey | HLVNHPRPALGDLM-FOWTUZBSSA-N |
| XLogP | 4.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|