C23H25ClFNO5 — CID 67579577
2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-[(Z)-3-(diethylamino)-2-methyl-3-oxoprop-1-enyl]phenoxy]acetic acid (PubChem CID 67579577) has the molecular formula C23H25ClFNO5 and a molecular weight of 449.91 g/mol. Its IUPAC name is 2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-[(Z)-3-(diethylamino)-2-methyl-3-oxoprop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-[(Z)-3-(diethylamino)-2-methyl-3-oxoprop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67579577 |
| Molecular Formula | C23H25ClFNO5 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-[(Z)-3-(diethylamino)-2-methyl-3-oxoprop-1-enyl]phenoxy]acetic acid |
| SMILES | CCN(CC)C(=O)/C(C)=C\c1ccc(OCc2c(F)cccc2Cl)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C23H25ClFNO5/c1-4-26(5-2)23(29)15(3)11-16-9-10-20(21(12-16)31-14-22(27)28)30-13-17-18(24)7-6-8-19(17)25/h6-12H,4-5,13-14H2,1-3H3,(H,27,28)/b15-11- |
| InChIKey | OAYFWMWJLZLFRL-PTNGSMBKSA-N |
| XLogP | 4.79 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|