C18H17ClFN3O3S — CID 102535138
[[(E)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]thiourea (PubChem CID 102535138) has the molecular formula C18H17ClFN3O3S and a molecular weight of 409.87 g/mol. Its IUPAC name is [[(E)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]thiourea.
| Compound Name | [[(E)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 102535138 |
| Molecular Formula | C18H17ClFN3O3S |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [[(E)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]thiourea |
| SMILES | COc1cc(/C=C/C(=O)NNC(N)=S)ccc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H17ClFN3O3S/c1-25-16-9-11(6-8-17(24)22-23-18(21)27)5-7-15(16)26-10-12-13(19)3-2-4-14(12)20/h2-9H,10H2,1H3,(H,22,24)(H3,21,23,27)/b8-6+ |
| InChIKey | UDDKQAGGALROLN-SOFGYWHQSA-N |
| XLogP | 2.94 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|