C22H23Cl2NO5 — CID 102534653
methyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]butanoate (PubChem CID 102534653) has the molecular formula C22H23Cl2NO5 and a molecular weight of 452.33 g/mol. Its IUPAC name is methyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]butanoate.
| Compound Name | methyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 102534653 |
| Molecular Formula | C22H23Cl2NO5 |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | methyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)/C=C/c1ccc(OCc2c(Cl)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H23Cl2NO5/c1-28-20-13-15(9-11-21(26)25-12-4-7-22(27)29-2)8-10-19(20)30-14-16-17(23)5-3-6-18(16)24/h3,5-6,8-11,13H,4,7,12,14H2,1-2H3,(H,25,26)/b11-9+ |
| InChIKey | OMHBPYOKIHMDBW-PKNBQFBNSA-N |
| XLogP | 4.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|