C18H20ClFN3O2S+ — CID 5010778
[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-(ethylcarbamothioylamino)azanium (PubChem CID 5010778) has the molecular formula C18H20ClFN3O2S+ and a molecular weight of 396.90 g/mol. Its IUPAC name is [4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-(ethylcarbamothioylamino)azanium.
| Compound Name | [4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-(ethylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 5010778 |
| Molecular Formula | C18H20ClFN3O2S+ |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-(ethylcarbamothioylamino)azanium |
| SMILES | CCNC(=S)N[NH+]=Cc1ccc(OCc2c(F)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H19ClFN3O2S/c1-3-21-18(26)23-22-10-12-7-8-16(17(9-12)24-2)25-11-13-14(19)5-4-6-15(13)20/h4-10H,3,11H2,1-2H3,(H2,21,23,26)/p+1 |
| InChIKey | ZXFZKNNTOGIEIL-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|