C22H20Cl2N3O2S+ — CID 4278394
[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 4278394) has the molecular formula C22H20Cl2N3O2S+ and a molecular weight of 461.39 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | [4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 4278394 |
| Molecular Formula | C22H20Cl2N3O2S+ |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | COc1cc(C=[NH+]NC(=S)Nc2ccccc2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3O2S/c1-28-21-12-15(13-25-27-22(30)26-17-5-3-2-4-6-17)8-10-20(21)29-14-16-7-9-18(23)19(24)11-16/h2-13H,14H2,1H3,(H2,26,27,30)/p+1 |
| InChIKey | TYLRZQKRHYUVOM-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|