C21H17Cl2NO4S — CID 110518689
(NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]benzenesulfonamide (PubChem CID 110518689) has the molecular formula C21H17Cl2NO4S and a molecular weight of 450.34 g/mol. Its IUPAC name is (NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 110518689 |
| Molecular Formula | C21H17Cl2NO4S |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | (NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]benzenesulfonamide |
| SMILES | COc1cc(/C=N\S(=O)(=O)c2ccccc2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2NO4S/c1-27-21-12-15(13-24-29(25,26)17-5-3-2-4-6-17)8-10-20(21)28-14-16-7-9-18(22)19(23)11-16/h2-13H,14H2,1H3/b24-13- |
| InChIKey | MMRQGRBPWFCCST-CFRMEGHHSA-N |
| XLogP | 5.39 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|