C17H13Cl2NO2 — CID 6092087
(E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 6092087) has the molecular formula C17H13Cl2NO2 and a molecular weight of 334.20 g/mol. Its IUPAC name is (E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6092087 |
| Molecular Formula | C17H13Cl2NO2 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | (E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C/C#N)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2NO2/c1-21-17-10-12(3-2-8-20)5-7-16(17)22-11-13-4-6-14(18)15(19)9-13/h2-7,9-10H,11H2,1H3/b3-2+ |
| InChIKey | OTHSGBXXZFSVNR-NSCUHMNNSA-N |
| XLogP | 5.12 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|