C23H16Cl3NO2 — CID 3466103
2-(2-chlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 3466103) has the molecular formula C23H16Cl3NO2 and a molecular weight of 444.75 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3466103 |
| Molecular Formula | C23H16Cl3NO2 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2ccccc2Cl)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H16Cl3NO2/c1-28-23-12-15(10-17(13-27)18-4-2-3-5-19(18)24)7-9-22(23)29-14-16-6-8-20(25)21(26)11-16/h2-12H,14H2,1H3 |
| InChIKey | ORQPDBLTPREJKL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|