C26H20Cl2N2O3 — CID 6295382
(E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile (PubChem CID 6295382) has the molecular formula C26H20Cl2N2O3 and a molecular weight of 479.36 g/mol. Its IUPAC name is (E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6295382 |
| Molecular Formula | C26H20Cl2N2O3 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (E)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)N2CCc3ccccc32)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N2O3/c1-32-25-14-17(7-9-24(25)33-16-18-6-8-21(27)22(28)13-18)12-20(15-29)26(31)30-11-10-19-4-2-3-5-23(19)30/h2-9,12-14H,10-11,16H2,1H3/b20-12+ |
| InChIKey | KPRDTNCTOVHCAA-UDWIEESQSA-N |
| XLogP | 6.08 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|