C28H25ClN2O3 — CID 6252353
(E)-3-[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile (PubChem CID 6252353) has the molecular formula C28H25ClN2O3 and a molecular weight of 472.97 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6252353 |
| Molecular Formula | C28H25ClN2O3 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (E)-3-[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)N2CCc3ccccc32)cc(Cl)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C28H25ClN2O3/c1-3-33-26-16-21(15-24(29)27(26)34-18-20-8-6-7-19(2)13-20)14-23(17-30)28(32)31-12-11-22-9-4-5-10-25(22)31/h4-10,13-16H,3,11-12,18H2,1-2H3/b23-14+ |
| InChIKey | FSTZXHAFMWHZHG-OEAKJJBVSA-N |
| XLogP | 6.12 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|