C31H30N2O4 — CID 6138140
(E)-2-(2,3-dihydroindole-1-carbonyl)-3-[3-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enenitrile (PubChem CID 6138140) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is (E)-2-(2,3-dihydroindole-1-carbonyl)-3-[3-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(2,3-dihydroindole-1-carbonyl)-3-[3-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6138140 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (E)-2-(2,3-dihydroindole-1-carbonyl)-3-[3-ethoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enenitrile |
| SMILES | C=CCc1ccccc1OCCOc1ccc(/C=C(\C#N)C(=O)N2CCc3ccccc32)cc1OCC |
| InChI | InChI=1S/C31H30N2O4/c1-3-9-25-11-6-8-13-28(25)36-18-19-37-29-15-14-23(21-30(29)35-4-2)20-26(22-32)31(34)33-17-16-24-10-5-7-12-27(24)33/h3,5-8,10-15,20-21H,1,4,9,16-19H2,2H3/b26-20+ |
| InChIKey | KGECMPXCLVOVHQ-LHLOQNFPSA-N |
| XLogP | 5.77 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|