C27H22Cl2N2O3 — CID 6112509
(E)-3-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile (PubChem CID 6112509) has the molecular formula C27H22Cl2N2O3 and a molecular weight of 493.39 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6112509 |
| Molecular Formula | C27H22Cl2N2O3 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (E)-3-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(2,3-dihydroindole-1-carbonyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)N2CCc3ccccc32)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H22Cl2N2O3/c1-2-33-25-15-18(14-23(29)26(25)34-17-20-8-3-5-9-22(20)28)13-21(16-30)27(32)31-12-11-19-7-4-6-10-24(19)31/h3-10,13-15H,2,11-12,17H2,1H3/b21-13+ |
| InChIKey | PQAUEGRYDYLNFZ-FYJGNVAPSA-N |
| XLogP | 6.47 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|